5 mL of 0.0040 M AgNO3 is added to 5 mL of 0.0024M K2CrO4:
- a) write a balanced equation for this reaction
- b) how many millimoles of AgNO3 will be produced from 5 mL of 0.0040 M AgNO3?
- c) how many millimoles of K2CrO4 will be produced from 5 mL of 0.0024 M K2CrO4?
- d) Which reactant is in excess?

Answers

Answer 1

a) The balanced equation for this reaction is 2 AgNO₃(aq) + K₂CrO₄(aq) → Ag₂CrO₄(s) + 2 KNO₃(aq)

b) The amount in millimoles of AgNO₃ will be produced from 5 mL of 0.0040 M AgNO₃ is 20 mmol.

c) The amount in millimoles of K₂CrO₄ will be produced from 5 mL of 0.0024 M K₂CrO₄ is 12 mmol.

d) The excess reactant is AgNO₃.

a) Balanced equation for this reaction:
2 AgNO₃(aq) + K₂CrO₄(aq) → Ag₂CrO₄(s) + 2 KNO₃(aq)

b) To find the millimoles of AgNO₃:
millimoles = volume (mL) × concentration (M)
millimoles of AgNO₃ = 5 mL × 0.0040 M = 20 mmol

c) To find the millimoles of K₂CrO₄:
millimoles = volume (mL) × concentration (M)
millimoles of K₂CrO₄ = 5 mL × 0.0024 M = 12 mmol

d) To determine the limiting reactant, we compare the mole ratio of the reactants:
Mole ratio of AgNO₃ to K₂CrO₄ = 2:1
Actual mole ratio = 20 mmol AgNO₃ : 12 mmol K₂CrO₄ = 10:6

Since the actual mole ratio has more moles of AgNO₃ than needed, K₂CrO₄ is the limiting reactant, and AgNO₃ is in excess.

Learn more about limiting reactant here: https://brainly.com/question/26905271

#SPJ11


Related Questions

how many moles of oxygen gas are produced in the decomposition of 5.00g of potassium chlorate?
Given: KClO3= O2+KCl

Answers

Answer:

0.0612 moles of O2 produced

Explanation:

     First we convert from grams of Potassium Chlorate to moles..

Amu = 122.5

5.00g / 122.5 g = 0.0408163265 moles of Potassium Chlorate

    Now we need to use the chemical equation to find the ratio of Potassium Chlorate to Oxygen... But first, we need to balance it

Original Chemical Equation : KClO3 = O2 + KCl

Balanced Chemical Equation : 2KClO3 = 3O2 + 2KCl

     Now we will use the balanced chemical equation to find the ratio of Potassium Chlorate to oxygen (in order to convert to moles of oxygen for our answer)

We can see that for every 2 moles of Potassium Chlorate that are decomposing, we have 3 moles of oxygen gas produced.

So, we will set up our conversion factor like this:

0.0408163265 moles KClO3 *   3 moles Oxygen

                                                     -------------------------

                                                     2 moles KClO3

When we solve for this, we see that there are 0.0612244898 moles of O2 produced, or 0.0612 moles of O2 produced

Which of the following statements is FALSE?
The microscopic size of cells enable them to function properly.
Most organisms on Earth are multi-celled.
Some cells can be shaped like a ball.
Growing children’s cells are constantly dividing.

Answers

Answer:

The answer is functioning properly ok dude?

Explanation:

Answer: "The microscopic size of cells enable them to function properly.

Most organisms on Earth are multi-celled." is false

Explanation:

In unicellular organisms, cell division is the means of reproduction; in multicellular organisms, it is the means of tissue growth and maintenance. Survival of the eukaryotes depends upon interactions between many cell types, and it is essential that a balanced distribution of types be maintained. This is achieved by the highly regulated process of cell proliferation. The growth and division of different cell populations are regulated in different ways, but the basic mechanisms are similar throughout multicellular organisms.

Who discovered the nucleus?

Answers

Ernest Rutherford i believe
Ernest Rutherford’s

What is Temperature
Choose 1

Answers

Answer:

B. A measure of the average kinetic energy of a substance.

Explanation:

Temperature is a measure of the average kinetic energy of the particles in an object.

Brainlist pls!

At what power of ten does the entire solar system come into view

Answers

Answer: 10,000,000,000 kilometers

Explanation:

All the planets in our solar system come into view. But at this distance, only Jupiter and Saturn would be visible with the naked eye.

If you know the atomic number and the mass number of an atom of any element, you can determine the atom's composition.

A:True
B:False​

Answers

True. i hope its correct, have a good day. stay happy and stay safe

Answer:

A:true

Explanation:

The number of protons, neutrons, and electrons in an atom can be determined from a set of simple rules.

19)
Why are unique atomic spectra produced by different elements?

Answers

When atoms are excited they emit light of certain wavelengths which correspond to different colors. Each element produces a unique set of spectral lines. ... Since no two elements emit the same spectral lines, elements can be identified by their line spectrum.

Which change will cause gravitational force between and a soccer ball to increase?

Answers

Answer:

Moving the balls closer together. The distance decreases and force increases.

The planets in the solar system revolve around the Sun because the Sun is

Answers

Answer: Anyway, the basic reason why the planets revolve around, or orbit, the Sun, is that the gravity of the Sun keeps them in their orbits. ... If the Sun weren't there, the Earth would travel in a straight line. But the gravity of the Sun alters its course, causing it to travel around the Sun, in a shape very near to a circle

Which of the following is NOT an atom that hydrogen bonds?

Select one:
a. Oxygen
b. Nitrogen
c. Fluorine
d. Sodium

Answers

Answer:

The answer is D sodium

Explanation:

Is it okay if you help me? I'm kind of in a tight spot here. Tysmmmmmmmmmmmmm o(❁´◡`❁)o!!

Answers

Answer:

the answer is true

Explanation:

it's just true

Picture a neutral Satom. This neutral atom will have
valence electrons. To reach a more stable configuration, this atom will
(gain, lose) electrons. The charge of the ion that forms will be
ASAP PLEASEE

Answers

Answer:

it will have 6 valence electrons

it will gain electrons

charge will be 2-

How many moles of Al would be produced from 20 moles of Al2O3?
2Al2O3
->
4A1 + 302

Answers

Answer:

[tex]\displaystyle 40 \ mol \ Al[/tex]

General Formulas and Concepts:

Math

Pre-Algebra

Order of Operations: BPEMDAS

Brackets Parenthesis Exponents Multiplication Division Addition Subtraction Left to Right

Chemistry

Stoichiometry

Using Dimensional AnalysisExplanation:

Step 1: Define

[RxN - Balanced] 2Al₂O₃ → 4Al + 3O₂

[Given] 20 mol Al₂O₃

Step 2: Identify Conversions

[RxN] 2 mol Al₂O₃ → 4 mol Al

Step 3: Stoich

[DA] Set up:                                                                                                     [tex]\displaystyle 20 \ mol \ Al_2O_3(\frac{4 \ mol \ Al}{2 \ mol \ Al_2O_3})[/tex][DA] Multiply/Divide [Cancel out units]:                                                         [tex]\displaystyle 40 \ mol \ Al[/tex]

Step 4:Check

Follow sig fig rules and round. We are given 1 sig fig.

Since our final answer already has 1 sig fig, there is no need to round.

differences between alkalis, bases and acids? (answer for many points :) )

Answers

Explanation:

protons.

An acid can also be thought of as a chemical that can neutralize a base. Similarly, a base can neutralize an acid.

Acids turn litmus paper red, while bases make litmus paper turn blue.

Some examples of acids are sulfuric acid, hydrochloric acid, nitric acid, and so on. Some examples of bases are sodium hydroxide, potassium hydroxide, and so on.

Acids generally taste sour, while bases have a bitter taste.

Alkalis are the bases that are water-soluble, which means that they dissolve in water. In other words, not all bases are water-soluble, and only the water-soluble bases are known as alkalis. An example of an alkali is sodium hydroxide. It is a base because it can neutralize an acid, and because it is water-soluble, it is an alkali. An example of a base that is not alkali is copper oxide. This chemical can neutralize an acid, but it is insoluble in water.

In other words, all alkali are bases but not all bases are alkalis.

Also, an alkali has a hydroxide group, while a base has an oxide group in it.

What is the atomic radius
of mercury?

Answers

The answer is 155 pm, hope this helps!

Why is salad dressing a solution?

Answers

Explanation:

A prime illustration of sour salad dressing formulas and suspension. Vinegar is also an acetic acid product which is dispersed in water, so we can't even see molecules in the oil. The removal throughout the liquid phase to make a solution.

describe nuclear change please​

Answers

Answer: Nuclear change is distinct from chemical change in that elements change. In the nuclear change the elements can change from one to another. (Nuclei can break apart to form smaller elements.)

Explanation:

Answer:

A nuclear change is a process by which nuclei of certain isotopes change spontaneously or are forced to change to two or more different isotopes.

Explanation:

The three main types of nuclear change in the matter are radioactive natural disintegration, nuclear fission, and nuclear fusion.

I like blowing up stuff too

constrast a mixture and a compound , how are. they different?​

Answers

Answer:

A mixture is composed of two or more elements or compounds in a non-fixed ratio, which means you can vary the amount of substance in a mixture. A compound is composed of two or more elements in a fixed ratio, so you cannot vary the amount of each element in a compound

Answer:

mixture retains property of combing substances while compound has new properties that are different from combing elements...

can be separated by physical means whereas compounds can be separated by chemical or electrochemical methods

Mg3N2+3H2O-3MgO+2NH3 If 17 g of magnesium nitride is used, what volume of ammonia gas would be collected at 20°C and 0.989 atm?​

Answers

Explanation:

what are the unit given for the questions

explain what keeps the electrons confined in the space surrounding the nucleus

Answers

Answer:

Electrons are trapped inside the atom because of the attraction forces with positively charged protons that are found in the nucleus.

if youre good at chemistry u better help me now please!

Answers

Answer:

letter B is the answer

Explanation:

just take a look at the atoms

Answer:

B.) Only elements have one kind of atom.

Explanation:

An element consists of only one type of atom, while a compound consists of two or more types of elements

Which is a liquid that is used to absorb and release thermal energy?

coolant
lubricant
grease
fuel

Answers

Answer

grese

Explanation:

Any liquid could absorb and release thermal energy. However, a refrigerant or a coolant absorbs heat and releases it to any area faster than any ordinary liquid such as water. So to complete the sentence: A refrigerant/cooler is a liquid that absorbs and releases thermal energy

Answer:

The correct answer is coolant.

Hope it helps. :)

HELPPPP!!!!
What property allows objects to be subject to gravity?
friction
mass
inertia
acceleration

Answers

I believe it is mass? Since gravity tells the weight of something. If its wrong I apologize. But consider the rest focus more on speed.

Why is systems thinking important?
Systems thinking ignores the details of a system and just looks at its overall function.
Systems thinking ranks the parts of a system in terms of most important to least.
Systems thinking allows us to understand all the parts that make up the whole system.
Systems thinking examines how a system affects human life.

Answers

Answer:

Systems thinking allows us to understand all the parts that make up the whole system.

Explanation:

Just took the test

The systems thinking important because, Systems thinking allows us to understand all the parts that make up the whole system. Therefore, option C is correct.

What system thinking ?

By considering the world's complexity in terms of links and entire rather than breaking it down into its component components, systems thinking helps us make sense of how complicated the world is. It has been applied as a method for investigating and producing efficient action in challenging situations.

By using a deeper grasp of the surrounding structure and its constituent parts rather than relying just on previous events, systems thinking gives a technique to more accurately forecast future outcomes.

Systems thinking is a discipline in management that focuses on understanding a system by looking at the connections and interactions between the different parts that make up the entire of that defined system. The concept of the "entire system" is a way of looking at an entire organization in relation to its surroundings.

Thus, option C is correct.

To learn more about system thinking, follow the link;

https://brainly.com/question/17174999

#SPJ2


You arrive at English class 45 seconds after leaving math which is 100
meters away. How fast did you travel?

Answers

Answer:

4.97097

Explanation:

You traveled 4.97097 mph.

2 NaOH + H2SO4 ------> 2 H2O + Na2SO4
How many moles of H2O can be produced from 12.5 moles of NaOH?

Answers

Explanation:

2moles of NaOH -> 2moles of H2O

so the number of moles r equal.

hence moles of H2O is 12.5

if an element number has a mass number of 244 and an atomic number of 94, how many neutrons does the element have

Answers

94 neutrons
The atomic number and the proton and electron numbers are the same.

what best describe the process of percipitation in the water cycle

Answers

Answer:

Precipitation is water released from clouds in the form of rain, freezing rain, sleet, snow, or hail. It is the primary connection in the water cycle that provides for the delivery of atmospheric water to the Earth. Most precipitation falls as rain.

Explanation:

What property allows objects to be subject to gravity?
friction
mass
inertia
acceleration

Answers

Answer:

Mass

Explanation:

HELLPP!!!
What property allows objects to be subject to gravity?
friction
mass
inertia
acceleration

Answers

Answer: i gotcu the answer is mass

Explanation: The more weight of the object the more its subject to gravity like a feather barley is while a bowling ball smashes into the ground :D

The property allows objects to be subject to gravity is mass. Therefore, option B is correct.

What is mass ?

Mass is a physical body's total amount of matter. Inertia, or the body's resistance to acceleration when a net force is applied, is also measured by this term.

The strength of an object's gravitational attraction to other bodies is also influenced by its mass. The kilogram serves as the SI's fundamental mass unit. The amount of matter object present is also known as mass.

The amount of matter that makes up every item or body is the greatest way to understand mass. Everything that we can see has mass. Examples of objects with mass include a table, a chair, your bed, a football, a glass, and even air. The mass of a thing determines whether it is light or heavy.

Thus, option B is correct.

To learn more about mass follow the link below;

https://brainly.com/question/19694949

#SPJ2

Other Questions
Find two positive consecutive odd intergers such that the square of the first, added to 3 times the second is 24 In PQR, the measure of R=90, the measure of Q=7, and PQ = 9. 4 feet. Find the length of QR to the nearest tenth of a foot an ecosystem has an ecological efficiency of 10 percent. if the producer level contains 10,000 kilocalories of energy, how much energy does the tertiary consumer level contain? Using two INSERT statements, store in the database the fact that PC model 1100 is made by manufacturer C, has speed 3.2, RAM 1024, hard disk 180, and sells for $2499.b) Insert the facts that for every PC there is a laptop with the same manufacturer, speed, RAM, and hard disk, a 17-inch screen, a model number 1100 greater, and a price $500 more.c) Delete all PC's with less than 100 gigabytes of hard disk.d) Delete all laptops made by a manufacturer that doesn't make printers.e) Manufacturer A buys manufacturer B. Change all products made by B so they are now made by A. A 0. 500-kg glider, attached to the end of an ideal spring with force constant k = 450N/m, undergoes SHM with an amplitude of 0. 040 m. Compute (a) the maximum speedof the glider; (b) the speed of the glider when it is at x = -0. 015 m; (c) the magnitude ofthe maximum acceleration of the glider; (d) the acceleration of the glider at x = -0. 015m; (e) the total mechanical energy of the glider at any point in its motion If the MPC in an economy is 0.5, government could shift the aggregate demand curve rightward by $60 billion by Multiple Choice 1. decreasing taxes by $60 billion. 2. increasing government spending by $60 billion. 3. increasing government spending by $30 billion. 4. decreasing taxes by $120 billion. there was little immediate reaction to cade's report that lithium helped alleviate the symptoms of manic patients. this was because to help you easily identify sheets in a workbook, you can add _____ to the sheet tab. select one: alignment fonts color styles A random sample of 7 patients are selected from a group of 25 and their cholesterol levels were recorded as follows:128, 127, 153, 144, 132, 120, 115Find the sample mean. the integral c[(3x2y y2)dx (x3 2xy)dy] is independent of the path. evaluate the integral where c is the path given parametrically by r=ti (t2 t2)j for 0t2. A way for policymakers to avoid the problems that deflation can present and still meet their objective of price stability is toMultiple Choicea)set a higher inflation target.b)keep the monetary base fixed.c)set a target of zero inflation.d)target a nominal interest rate of zero. At different times in American history, especially directlyafter World War Two and despite their need for safety, theUnited States was_____accepting refugees.A)againstB)in favor ofC)undecided aboutD)interested in a nurse is planning care for a client and her husband recently diagnosed with multiple sclerosis and wanting to prevent pregnancy for now. what is the most appropriate nursing diagnosis for this couple? approximately how many teenagers develop drinking problems or permit alcohol to adversely affect their schooling or personal relationships? small changes in the orbits of planets caused by the gravitational pull of the other planets in the solar system are called: What is the free energy change in kJmol associated with the following reaction under standard conditions? CH3COOH(l)+2O2(g)2CO2(g)+2H2O(g) The standard free energy of formation data are as follows: Gf,CH3COOH(l)=-389.9kJmolGf,CO2(g)=-394.4kJmolGf,H2O(g)=-228.6kJmol TRUE/FALSE. each individual experiences pain differently. it has been found that depending on your culture Which of the following bodies of evidence support the African model for modern human origins?-genetic evidence-fossil evidence-written evidence-archaeological evidence a low level of _____ is the main reason for the uncontrollable shaking seen in patients with parkinson's disease and in patients who are taking conventional antipsychotics. Four equal strips A B C and D were cut from a potato whose cell sap concentration was 28.5%sugar. The strips were placed in sugar solutions of different concentrations as follows;A-10%,B-15%,C-25%,D-35%. 1.What changes would you expect in strips A and D? 2.Account for the changes in A and D.